CAS 264264-32-6 appears in our catalog under these names: 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoic acid, 98%, 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid, 98%, 98%, 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid (CAS 264264-32-6) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid. InChIKey: CEBJCUYZEOLQSC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid |
| InChIKey | CEBJCUYZEOLQSC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)