CAS 26451-92-3 appears in our catalog under these names: Naloxone EP Impurity D, Naloxone Impurity 4(Naloxone EP Impurity D), 7,8-Didehydro Naloxone, >95% (HPLC), 7,8-Didehydro Naloxone (~85%), >95% (HPLC), 7,8-Didehydro Naloxone (1.0 mg/mL in Acetonitrile). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 1x1ml.
(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (CAS 26451-92-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one. InChIKey: VHFYKBURRFNDQL-GRGSLBFTSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| InChIKey | VHFYKBURRFNDQL-GRGSLBFTSA-N |
| SMILES | C=CCN1CC[C@]23[C@@H]4C(=O)C=C[C@]2([C@H]1CC5=C3C(=C(C=C5)O)O4)O |
Computed by PubChem (NCBI)