CAS 2646593-05-5 is the registry number for 7-Methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine (CAS 2646593-05-5) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 7-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: KBZWWBMREUEGBL-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 7-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | KBZWWBMREUEGBL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NN=CN2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)