Products 265670-72-2
CAS 265670-72-2 appears in our catalog under these names: 6–fluoro–2，3–dimethoxybenzoic acid, 6-Fluoro-2,3-dimethoxybenzoic acid 95%, 6-Fluoro-2,3-dimethoxybenzoic acid, 95%, 95%, 6-Fluoro-2,3-dimethoxybenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-fluoro-2,3-dimethoxybenzoic acid (CAS 265670-72-2) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 6-fluoro-2,3-dimethoxybenzoic acid. InChIKey: OXYSHPNWRGUQPS-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 6-fluoro-2,3-dimethoxybenzoic acid |
| InChIKey | OXYSHPNWRGUQPS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
6-Fluoro-2,3-dimethoxybenzoic acid, benzoic acid, 6-fluoro-2,3-dimethoxy-, InChI=1/C9H9FO4/c1-13-6-4-3-5(10)7(9(11)12)8(6)14-2/h3-4H,1-2H3,(H,11,12, 5,6-Dimethoxy-2-fluorobenzoic acid, 6-Fluoro-2,3-dimethoxy-benzoic acid, 6-Fluoro-2,3-dimethoxybenzoicacid, OXYSHPNWRGUQPS-UHFFFAOYSA-N, 6-Fluoro-2,3-dimethoxybenzoic acid #, 6-Fluoro-2,3-dimethoxybenzoicacid,95%, Benzoic acid, 2-fluoro-5,6-dimethoxy-