CAS 266360-62-7 appears in our catalog under these names: D-2,6-Difluorophenyl-alanine, 95%, (R)-2-Amino-3-(2,6-difluorophenyl)propanoic acid, 95%, 95%, 2,6-Difluoro-D-phenylalanine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-amino-3-(2,6-difluorophenyl)propanoic acid (CAS 266360-62-7) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (2R)-2-amino-3-(2,6-difluorophenyl)propanoic acid. InChIKey: RFOVYDPRGDZBLJ-MRVPVSSYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,6-difluorophenyl)propanoic acid |
| InChIKey | RFOVYDPRGDZBLJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C[C@H](C(=O)O)N)F |
Computed by PubChem (NCBI)