Products 2676865-16-8
CAS 2676865-16-8 is the registry number for Ethyl 3-hydroxy-4-nitro-1,5,6,7-tetrahydro-s-indacene-2-carboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3-hydroxy-4-nitro-1,5,6,7-tetrahydro-s-indacene-2-carboxylate (CAS 2676865-16-8) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: ethyl 3-hydroxy-4-nitro-1,5,6,7-tetrahydro-s-indacene-2-carboxylate. InChIKey: KOPAITBSMXIWJK-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | ethyl 3-hydroxy-4-nitro-1,5,6,7-tetrahydro-s-indacene-2-carboxylate |
| InChIKey | KOPAITBSMXIWJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C1)C=C3CCCC3=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)