Products 2676865-60-2
CAS 2676865-60-2 is the registry number for 6-Fluoro-4-nitro-5-(prop-1-en-2-yl)-2,3-dihydro-1H-indene, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g.
6-fluoro-4-nitro-5-prop-1-en-2-yl-2,3-dihydro-1H-indene (CAS 2676865-60-2) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: 6-fluoro-4-nitro-5-prop-1-en-2-yl-2,3-dihydro-1H-indene. InChIKey: QJDGTUBFIOBEDL-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 6-fluoro-4-nitro-5-prop-1-en-2-yl-2,3-dihydro-1H-indene |
| InChIKey | QJDGTUBFIOBEDL-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=C(C=C2CCCC2=C1[N+](=O)[O-])F |
Computed by PubChem (NCBI)