Products 2677030-93-0
CAS 2677030-93-0 is the registry number for 2-(2-(2-Amino-4-chlorobenzyl)-1,3-dioxolan-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[(2-amino-4-chlorophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid (CAS 2677030-93-0) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 2-[2-[(2-amino-4-chlorophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid. InChIKey: WRXFNSACSUKXON-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 2-[2-[(2-amino-4-chlorophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid |
| InChIKey | WRXFNSACSUKXON-UHFFFAOYSA-N |
| SMILES | C1COC(O1)(CC2=C(C=C(C=C2)Cl)N)CC(=O)O |
Computed by PubChem (NCBI)