Products 2680702-05-8
CAS 2680702-05-8 is the registry number for 5-(1-Acetylazetidin-3-yl)oxazole-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-(1-acetylazetidin-3-yl)-1,3-oxazole-4-carboxylic acid (CAS 2680702-05-8) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 5-(1-acetylazetidin-3-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: ZJVAZFZXDSMWTP-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 5-(1-acetylazetidin-3-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZJVAZFZXDSMWTP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)