Products 2680736-73-4
CAS 2680736-73-4 is the registry number for Benzyl (2,4-dihydroxybenzyl)carbamate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzyl N-[(2,4-dihydroxyphenyl)methyl]carbamate (CAS 2680736-73-4) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: benzyl N-[(2,4-dihydroxyphenyl)methyl]carbamate. InChIKey: XBGTZIFWQFKQLM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | benzyl N-[(2,4-dihydroxyphenyl)methyl]carbamate |
| InChIKey | XBGTZIFWQFKQLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)