CAS 2683-66-1 appears in our catalog under these names: 4-(Benzyloxy)pyridine 1-oxide 98%, 4-(Benzyloxy)pyridine 1-oxide, 98%, 4-Benzyloxypyridine N-Oxide, 4–(Benzyloxy)pyridine N–oxide, 4-Benzyloxypyridine N-oxide, 98% . Offered by: Ambeed, Fluorochem, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 25g, 100g.
1-oxido-4-phenylmethoxypyridin-1-ium (CAS 2683-66-1) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-oxido-4-phenylmethoxypyridin-1-ium. InChIKey: SUSQPKJQYWTFPU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-oxido-4-phenylmethoxypyridin-1-ium |
| InChIKey | SUSQPKJQYWTFPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)