CAS 2684294-30-0 is the registry number for 7-Amino-4-ethyl-1H-indole-3-carbonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
7-amino-4-ethyl-1H-indole-3-carbonitrile (CAS 2684294-30-0) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 7-amino-4-ethyl-1H-indole-3-carbonitrile. InChIKey: MFNFAOWVXPZKSB-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 7-amino-4-ethyl-1H-indole-3-carbonitrile |
| InChIKey | MFNFAOWVXPZKSB-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CNC2=C(C=C1)N)C#N |
Computed by PubChem (NCBI)