CAS 268749-51-5 appears in our catalog under these names: (R)-2-Amino-2-phenylpropionic acid hydrochloride, 95%, (R)-2-Amino-2-phenylpropionic acid hydrochloride, (R)-2-Amino-2-phenylpropanoic acid hydrochloride 97%, (R)-2-Amino-2-phenylpropionic acid, HCl, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-amino-2-phenylpropanoic acid;hydrochloride (CAS 268749-51-5) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: (2R)-2-amino-2-phenylpropanoic acid;hydrochloride. InChIKey: JLVPLCVIBPZJQG-SBSPUUFOSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | (2R)-2-amino-2-phenylpropanoic acid;hydrochloride |
| InChIKey | JLVPLCVIBPZJQG-SBSPUUFOSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)