CAS 2688845-71-6 is the registry number for Pranoprofen Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5H-chromeno[2,3-b]pyridin-7-yl)-2-hydroxypropan-1-one (CAS 2688845-71-6) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 1-(5H-chromeno[2,3-b]pyridin-7-yl)-2-hydroxypropan-1-one. InChIKey: OQVCXOZQALLIPA-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-(5H-chromeno[2,3-b]pyridin-7-yl)-2-hydroxypropan-1-one |
| InChIKey | OQVCXOZQALLIPA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3)O |
Computed by PubChem (NCBI)