Products 26922-44-1
CAS 26922-44-1 is the registry number for 2’-Deoxy-3’,2-anhydrouridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,9S,10R)-10-(hydroxymethyl)-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one (CAS 26922-44-1) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (1R,9S,10R)-10-(hydroxymethyl)-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one. InChIKey: OEYRUBVMMWUGKQ-SHYZEUOFSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (1R,9S,10R)-10-(hydroxymethyl)-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one |
| InChIKey | OEYRUBVMMWUGKQ-SHYZEUOFSA-N |
| SMILES | C1[C@H]2[C@H](O[C@H]1N3C=CC(=O)N=C3O2)CO |
Computed by PubChem (NCBI)