Products 269396-67-0

CAS 269396-67-0 is the registry number for (R)-3-Amino-4-(4-pyridyl)-butyric acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(3R)-3-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride (CAS 269396-67-0) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: (3R)-3-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride. InChIKey: MZNNPQGCGVXSQK-YCBDHFTFSA-N.

Identity
Molecular formulaC9H14Cl2N2O2
Molecular weight253.12 g/mol
IUPAC name(3R)-3-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride
InChIKeyMZNNPQGCGVXSQK-YCBDHFTFSA-N
SMILESC1=CN=CC=C1C[C@H](CC(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)