CAS 1369501-61-0 appears in our catalog under these names: Methyl 3-amino-3-(pyridin-4-yl)propanoate dihydrochloride, 95%, Methyl 3-amino-3-(pyridin-4-yl)propanoate dihydrochloride, 95+%, Methyl 3-amino-3-(pyridin-4-yl)propanoate dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Methyl 3-amino-3-pyridin-4-ylpropanoate;dihydrochloride (CAS 1369501-61-0) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: methyl 3-amino-3-pyridin-4-ylpropanoate;dihydrochloride. InChIKey: NSTORCLCXFBAKE-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl 3-amino-3-pyridin-4-ylpropanoate;dihydrochloride |
| InChIKey | NSTORCLCXFBAKE-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)