CAS 1251923-50-8 appears in our catalog under these names: 3-[(Pyridin-3-ylmethyl)amino]propanoic acid dihydrochloride, 95%, 3-((Pyridin-3-ylmethyl)amino)propanoic acid dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
3-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride (CAS 1251923-50-8) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: 3-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride. InChIKey: SHZQGUIRDCBUSU-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 3-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride |
| InChIKey | SHZQGUIRDCBUSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNCCC(=O)O.Cl.Cl |
Computed by PubChem (NCBI)