CAS 2442565-30-0 appears in our catalog under these names: (S)-2-Amino-3-(4-hydroxyphenyl)propanamide dihydrochloride, 97%, (S)-2-Amino-3-(4-hydroxyphenyl)propanamide dihydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 1g, 25g.
(2S)-2-amino-3-(4-hydroxyphenyl)propanamide;dihydrochloride (CAS 2442565-30-0) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxyphenyl)propanamide;dihydrochloride. InChIKey: QQYNFOMWBDXPHK-JZGIKJSDSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxyphenyl)propanamide;dihydrochloride |
| InChIKey | QQYNFOMWBDXPHK-JZGIKJSDSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)N)N)O.Cl.Cl |
Computed by PubChem (NCBI)