CAS 1197231-86-9 appears in our catalog under these names: 3-Amino-3-pyridin-2-yl-propionic acid methyl ester dihydrochloride, 95%, Methyl 3–amino–3–(pyridin–2–yl)propanoate dihydrochloride, 3-Amino-3-pyridin-2-yl-propionic acid methyl ester, dihydrochloride, Methyl 3-amino-3-(pyridin-2-yl)propanoate dihydrochloride, 95%, 95%, Methyl 3-amino-3-(pyridin-2-yl)propanoate dihydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
Methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride (CAS 1197231-86-9) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride. InChIKey: JMILGFYNSSLFRJ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride |
| InChIKey | JMILGFYNSSLFRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)