Products 908571-75-5
CAS 908571-75-5 appears in our catalog under these names: (S)-2-Amino-3-(3-aminophenyl)propanoic acid dihydrochloride, 95%, (S)–2–Amino–3–(3–aminophenyl)propanoic acid dihydrochloride, (S)-2-Amino-3-(3-aminophenyl)propanoic acid dihydrochloride, 97%, 97%, (S)-2-Amino-3-(3-aminophenyl)propanoic acid dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride (CAS 908571-75-5) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: (2S)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride. InChIKey: KUYMDLJJQHYMCD-JZGIKJSDSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride |
| InChIKey | KUYMDLJJQHYMCD-JZGIKJSDSA-N |
| SMILES | C1=CC(=CC(=C1)N)C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)