CAS 269409-74-7 appears in our catalog under these names: 3-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, 97%, 3-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 3-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 269409-74-7) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: YEGJMUXHTVEBND-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | YEGJMUXHTVEBND-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)