Products 2696-03-9

CAS 2696-03-9 appears in our catalog under these names: 2,8–Diazaspiro(4·5)decane–1,3–dione hydrochloride, 2,8-Diazaspiro[4.5]decane-1,3-dione hydrochloride, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride (CAS 2696-03-9) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride. InChIKey: DCDGCHXHDAWBFH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2
Molecular weight204.65 g/mol
IUPAC name2,8-diazaspiro[4.5]decane-1,3-dione;hydrochloride
InChIKeyDCDGCHXHDAWBFH-UHFFFAOYSA-N
SMILESC1CNCCC12CC(=O)NC2=O.Cl

Computed by PubChem (NCBI)