Products 26961-99-9
CAS 26961-99-9 appears in our catalog under these names: 4-(N-methylacetamido)benzoic acid, 97%, 4-(N-methylacetamido)benzoic acid, 4-(N-Methylacetamido)benzoic acid 97%, 4-(N-Methylacetamido)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 0,5g, 100mg, 250mg.
4-[acetyl(methyl)amino]benzoic acid (CAS 26961-99-9) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4-[acetyl(methyl)amino]benzoic acid. InChIKey: WPHGIIWEXHFKHI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-[acetyl(methyl)amino]benzoic acid |
| InChIKey | WPHGIIWEXHFKHI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)