CAS 26989-20-8 appears in our catalog under these names: Codonopsine, (-)-Codonopsine. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(2R,3R,4R,5R)-2-(3,4-dimethoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol (CAS 26989-20-8) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(3,4-dimethoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol. InChIKey: WCNPJVPXLWJQIR-HKSFMPNISA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(3,4-dimethoxyphenyl)-1,5-dimethylpyrrolidine-3,4-diol |
| InChIKey | WCNPJVPXLWJQIR-HKSFMPNISA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H](N1C)C2=CC(=C(C=C2)OC)OC)O)O |
Computed by PubChem (NCBI)