CAS 27012-25-5 appears in our catalog under these names: 5–Bromo–2–phenylpyridine, 5-Bromo-2-phenylpyridine 97%, 5-Bromo-2-phenylpyridine, 95%, 5-Bromo-2-phenylpyridine, >98.0%(GC), Pyridine, 5-bromo-2-phenyl-, 99%, 99%. Offered by: GLPBio, Ambeed, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 500g, 10g, 250g.
5-bromo-2-phenylpyridine (CAS 27012-25-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 5-bromo-2-phenylpyridine. InChIKey: PRNGIODVYLTUKH-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 5-bromo-2-phenylpyridine |
| InChIKey | PRNGIODVYLTUKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)