Products 2704466-35-1
CAS 2704466-35-1 is the registry number for (αS)-α-[[(1,1-Dimethylethoxy)carbonyl]methylamino]cyclopentaneacetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-cyclopentyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (CAS 2704466-35-1) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid. InChIKey: ZKDMONMJNKQISL-JTQLQIEISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (2S)-2-cyclopentyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| InChIKey | ZKDMONMJNKQISL-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](C1CCCC1)C(=O)O |
Computed by PubChem (NCBI)