Products 2708287-15-2
CAS 2708287-15-2 appears in our catalog under these names: 5-(Benzyloxy)-6-methylpyrimidine-4-carboxylic Acid, 98%, 98%, 5-(Benzyloxy)-6-methylpyrimidine-4-carboxylic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
6-methyl-5-phenylmethoxypyrimidine-4-carboxylic acid (CAS 2708287-15-2) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 6-methyl-5-phenylmethoxypyrimidine-4-carboxylic acid. InChIKey: YAZPLBRCOOIWTN-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 6-methyl-5-phenylmethoxypyrimidine-4-carboxylic acid |
| InChIKey | YAZPLBRCOOIWTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=N1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)