CAS 2713139-71-8 is the registry number for Lenvatinib Impurity 115. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-7-methoxyquinoline-6-carboxamide (CAS 2713139-71-8) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 4,5-dichloro-7-methoxyquinoline-6-carboxamide. InChIKey: LMNCQCWBASNCOO-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 4,5-dichloro-7-methoxyquinoline-6-carboxamide |
| InChIKey | LMNCQCWBASNCOO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C(=C1C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)