CAS 2241758-00-7 appears in our catalog under these names: 2,4-Dichloro-7-methoxyquinoline-6-carboxamide, 98%, Lenvatinib Impurity 86. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-methoxyquinoline-6-carboxamide (CAS 2241758-00-7) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 2,4-dichloro-7-methoxyquinoline-6-carboxamide. InChIKey: XGMIKFYTXJHOMN-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 2,4-dichloro-7-methoxyquinoline-6-carboxamide |
| InChIKey | XGMIKFYTXJHOMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(C=C2Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)