CAS 1312605-84-7 is the registry number for Ethyl 2,4-dichloro-1,5-naphthyridine-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,4-dichloro-1,5-naphthyridine-3-carboxylate (CAS 1312605-84-7) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: ethyl 2,4-dichloro-1,5-naphthyridine-3-carboxylate. InChIKey: YWCHXRQPRYDEGW-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | ethyl 2,4-dichloro-1,5-naphthyridine-3-carboxylate |
| InChIKey | YWCHXRQPRYDEGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC=N2)N=C1Cl)Cl |
Computed by PubChem (NCBI)