CAS 133113-04-9 appears in our catalog under these names: 3-(2,4-Dichlorophenyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%, 3-(2,4-Dichlorophenyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(2,4-dichlorophenyl)-1-methylpyrazole-5-carboxylic acid (CAS 133113-04-9) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: HADPRTBSIZWBBE-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | HADPRTBSIZWBBE-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)