CAS 2254573-75-4 appears in our catalog under these names: 2-(2-Chloro-5-nitrophenyl)pyridine hydrochloride, 95%, 2-(2-Chloro-5-nitrophenyl)pyridine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
2-(2-chloro-5-nitrophenyl)pyridine;hydrochloride (CAS 2254573-75-4) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 2-(2-chloro-5-nitrophenyl)pyridine;hydrochloride. InChIKey: PNXLTXPOCFTTOX-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 2-(2-chloro-5-nitrophenyl)pyridine;hydrochloride |
| InChIKey | PNXLTXPOCFTTOX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=C(C=CC(=C2)[N+](=O)[O-])Cl.Cl |
Computed by PubChem (NCBI)