CAS 2718971-74-3 is the registry number for 4-Chloro-2,6,7-trimethoxyquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2,6,7-trimethoxyquinoline (CAS 2718971-74-3) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 4-chloro-2,6,7-trimethoxyquinoline. InChIKey: RRBDDGRRWMGIOD-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 4-chloro-2,6,7-trimethoxyquinoline |
| InChIKey | RRBDDGRRWMGIOD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=N2)OC)Cl)OC |
Computed by PubChem (NCBI)