Products 272126-07-5
CAS 272126-07-5 is the registry number for 4-Butyl-alpha-agarofuran, 98.0%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 5 mg.
(1R,6S,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (CAS 272126-07-5) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: (1R,6S,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene. InChIKey: RMGSYWBFOGEHLE-NJAFHUGGSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | (1R,6S,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| InChIKey | RMGSYWBFOGEHLE-NJAFHUGGSA-N |
| SMILES | CCCCC1=CCC[C@@]2([C@]13C[C@@H](CC2)C(O3)(C)C)C |
Computed by PubChem (NCBI)