Products 2724940-56-9
CAS 2724940-56-9 is the registry number for 5-{1-[(tert-butoxy)carbonyl]azetidin-3-yl}pyrazine-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 1g.
5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazine-2-carboxylic acid (CAS 2724940-56-9) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazine-2-carboxylic acid. InChIKey: UMVYLQZBFNQMPM-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazine-2-carboxylic acid |
| InChIKey | UMVYLQZBFNQMPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CN=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)