Products 2725741-73-9
CAS 2725741-73-9 is the registry number for (4-Chloro-2-methylbenzofuran-7-yl)methanol, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-chloro-2-methyl-1-benzofuran-7-yl)methanol (CAS 2725741-73-9) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: (4-chloro-2-methyl-1-benzofuran-7-yl)methanol. InChIKey: OXTBBSFVFHKJOI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (4-chloro-2-methyl-1-benzofuran-7-yl)methanol |
| InChIKey | OXTBBSFVFHKJOI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2O1)CO)Cl |
Computed by PubChem (NCBI)