Products 2725791-28-4
CAS 2725791-28-4 is the registry number for 1-tert-butoxycarbonyl-3,4,4-trimethyl-pyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
3,4,4-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2725791-28-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 3,4,4-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: NQIURXNITMNVND-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 3,4,4-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | NQIURXNITMNVND-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC1(C)C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)