Products 2732868-75-4
CAS 2732868-75-4 is the registry number for 2-Chloro-1-(3,4-dihydroxyphenyl)ethanone-d5. Offered by: TRC. Available pack sizes: 50mg.
2-chloro-2,2-dideuterio-1-(2,3,6-trideuterio-4,5-dihydroxyphenyl)ethanone (CAS 2732868-75-4) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 191.62 g/mol. IUPAC name: 2-chloro-2,2-dideuterio-1-(2,3,6-trideuterio-4,5-dihydroxyphenyl)ethanone. InChIKey: LWTJEJCZJFZKEL-QUWGTZMWSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 191.62 g/mol |
| IUPAC name | 2-chloro-2,2-dideuterio-1-(2,3,6-trideuterio-4,5-dihydroxyphenyl)ethanone |
| InChIKey | LWTJEJCZJFZKEL-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C([2H])([2H])Cl)[2H])O)O)[2H] |
Computed by PubChem (NCBI)