Products 27329-27-7
CAS 27329-27-7 appears in our catalog under these names: 4–Methyl–2–nitrobenzoic acid, 4-Methyl-2-nitrobenzoic acid 98%, 4-Methyl-2-nitrobenzoic acid, 98%, 98%, 4-Methyl-2-nitrobenzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 500g.
4-methyl-2-nitrobenzoic acid (CAS 27329-27-7) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-methyl-2-nitrobenzoic acid. InChIKey: KZLLSSGOPIGKDO-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-methyl-2-nitrobenzoic acid |
| InChIKey | KZLLSSGOPIGKDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)