Products 2733698-17-2

CAS 2733698-17-2 is the registry number for Isavuconazole Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-[ethenoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate (CAS 2733698-17-2) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: [2-[ethenoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate. InChIKey: HHWWFLOAMBLMJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17N3O4
Molecular weight279.29 g/mol
IUPAC name[2-[ethenoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate
InChIKeyHHWWFLOAMBLMJQ-UHFFFAOYSA-N
SMILESCNCC(=O)OCC1=C(N=CC=C1)N(C)C(=O)OC=C

Computed by PubChem (NCBI)