Products 2734702-92-0
CAS 2734702-92-0 appears in our catalog under these names: (AlphaZ)-Alpha-(Methoxyimino)-2-methylbenzeneacetic-d7 Acid Methyl Ester, (aZ)-a-(Methoxyimino)-2-methylbenzeneacetic-d7 Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Methyl (2Z)-2-methoxyimino-2-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]acetate (CAS 2734702-92-0) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 214.27 g/mol. IUPAC name: methyl (2Z)-2-methoxyimino-2-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]acetate. InChIKey: YCINJZQUXAFTQD-LAADDBIVSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | methyl (2Z)-2-methoxyimino-2-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]acetate |
| InChIKey | YCINJZQUXAFTQD-LAADDBIVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])/C(=N/OC)/C(=O)OC)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)