CAS 273930-52-2 is the registry number for NS4591. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,5-dichloro-1,3-diethylbenzimidazol-2-one (CAS 273930-52-2) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 4,5-dichloro-1,3-diethylbenzimidazol-2-one. InChIKey: PHJOFWDUFPTPDH-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 4,5-dichloro-1,3-diethylbenzimidazol-2-one |
| InChIKey | PHJOFWDUFPTPDH-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C(=C(C=C2)Cl)Cl)N(C1=O)CC |
Computed by PubChem (NCBI)