CAS 2739982-66-0 appears in our catalog under these names: (S)-6,7-Dihydro-5H-cyclopenta(b)pyridin-5-amine dihydrochloride, 98%, (5S)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(5S)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride (CAS 2739982-66-0) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: (5S)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride. InChIKey: ISGBINZZMGWDES-KLXURFKVSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | (5S)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride |
| InChIKey | ISGBINZZMGWDES-KLXURFKVSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)