Products 2765452-27-3
CAS 2765452-27-3 appears in our catalog under these names: (R)-6,7-Dihydro-5H-cyclopenta[b]pyridin-5-amine dihydrochloride, 95%, (5R)-6,7-Dihydro-5H-cyclopenta[b]pyridin-5-amine dihydrochloride, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
(5R)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride (CAS 2765452-27-3) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: (5R)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride. InChIKey: ISGBINZZMGWDES-XCUBXKJBSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | (5R)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine;dihydrochloride |
| InChIKey | ISGBINZZMGWDES-XCUBXKJBSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)