CAS 2740593-38-6 appears in our catalog under these names: (S)-Oxetan-2-ylmethanamine 4-methylbenzenesulfonate, 98%, 98%, (S)-Oxetan-2-ylmethanamine 4-methylbenzenesulfonate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g.
4-methylbenzenesulfonic acid;[(2S)-oxetan-2-yl]methanamine (CAS 2740593-38-6) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;[(2S)-oxetan-2-yl]methanamine. InChIKey: YLMXEOCOICWSKH-VWMHFEHESA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;[(2S)-oxetan-2-yl]methanamine |
| InChIKey | YLMXEOCOICWSKH-VWMHFEHESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1CO[C@@H]1CN |
Computed by PubChem (NCBI)