CAS 76143-71-0 appears in our catalog under these names: 5,7-Dichlorochroman-4-one, 95+%, 5,7-Dichloro-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5,7-dichloro-2,3-dihydrochromen-4-one (CAS 76143-71-0) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-2,3-dihydrochromen-4-one. InChIKey: LTWDKHFUIPDBEU-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dihydrochromen-4-one |
| InChIKey | LTWDKHFUIPDBEU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)