CAS 2742660-33-7 is the registry number for 4-Hydroxytryptamine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
3-(2-aminoethyl)-1H-indol-4-ol;hydrochloride (CAS 2742660-33-7) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indol-4-ol;hydrochloride. InChIKey: SFAXQAMOFRZYJJ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-4-ol;hydrochloride |
| InChIKey | SFAXQAMOFRZYJJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)