Products 2743131-73-7
CAS 2743131-73-7 is the registry number for 4-(difluoromethyl)-2-methylaniline hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-(difluoromethyl)-2-methylaniline;hydrochloride (CAS 2743131-73-7) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 4-(difluoromethyl)-2-methylaniline;hydrochloride. InChIKey: SSZILWYPWJGGBU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-methylaniline;hydrochloride |
| InChIKey | SSZILWYPWJGGBU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(F)F)N.Cl |
Computed by PubChem (NCBI)