CAS 2743741-36-6 is the registry number for 5-Hydroxypyrazine-2-carboxylic Acid-13C3. Offered by: TRC. Available pack sizes: 50mg.
6-oxo-(2,3-13C2)1H-pyrazine-3-carboxylic acid (CAS 2743741-36-6) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 143.08 g/mol. IUPAC name: 6-oxo-(2,3-13C2)1H-pyrazine-3-carboxylic acid. InChIKey: CGQFCIHUUCMACC-CGANOEODSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 143.08 g/mol |
| IUPAC name | 6-oxo-(2,3-13C2)1H-pyrazine-3-carboxylic acid |
| InChIKey | CGQFCIHUUCMACC-CGANOEODSA-N |
| SMILES | C1=N[13C](=[13CH]NC1=O)[13C](=O)O |
Computed by PubChem (NCBI)